CAS 170353-57-8 appears in our catalog under these names: (6-Chloro-2,3-dihydro-1,4-benzodioxin-2-yl)methanol, 95%, (6-Chloro-2,3-dihydrobenzo(b)(1,4)dioxin-2-yl)methanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(6-chloro-2,3-dihydro-1,4-benzodioxin-2-yl)methanol (CAS 170353-57-8) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: (6-chloro-2,3-dihydro-1,4-benzodioxin-2-yl)methanol. InChIKey: LJINDSYFYHYUEU-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | (6-chloro-2,3-dihydro-1,4-benzodioxin-2-yl)methanol |
| InChIKey | LJINDSYFYHYUEU-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(O1)C=C(C=C2)Cl)CO |
Computed by PubChem (NCBI)