CAS 1704073-49-3 appears in our catalog under these names: (3-Fluoro-5-(4-methylpiperazin-1-yl)phenyl)boronic acid, 95%, (3-fluoro-5-(4-methylpiperazin-1-yl)phenyl)boronic acid, 95+%, (3–Fluoro–5–(4–methylpiperazin–1–yl)phenyl)boronic acid, (3-fluoro-5-(4-methylpiperazin-1-yl)phenyl)boronic acid, 98%, 98%, (3-FLUORO-5-(4-METHYLPIPERAZIN-1-YL)PHENYL)BORONIC ACID, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
[3-fluoro-5-(4-methylpiperazin-1-yl)phenyl]boronic acid (CAS 1704073-49-3) is a chemical compound with the molecular formula C11H16BFN2O2 and a molecular weight of 238.07 g/mol. IUPAC name: [3-fluoro-5-(4-methylpiperazin-1-yl)phenyl]boronic acid. InChIKey: LOIYMTSRYIXULX-UHFFFAOYSA-N.
| Molecular formula | C11H16BFN2O2 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | [3-fluoro-5-(4-methylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | LOIYMTSRYIXULX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)