CAS 2223051-77-0 is the registry number for 5-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 2223051-77-0) is a chemical compound with the molecular formula C11H16BFN2O2 and a molecular weight of 238.07 g/mol. IUPAC name: 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: JIXKZGXEWUGBLC-UHFFFAOYSA-N.
| Molecular formula | C11H16BFN2O2 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | JIXKZGXEWUGBLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2F)N |
Computed by PubChem (NCBI)