Products 2589697-00-5
CAS 2589697-00-5 is the registry number for 3-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine (CAS 2589697-00-5) is a chemical compound with the molecular formula C11H16BFN2O2 and a molecular weight of 238.07 g/mol. IUPAC name: 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine. InChIKey: FZIVGEAJDVOEKM-UHFFFAOYSA-N.
| Molecular formula | C11H16BFN2O2 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine |
| InChIKey | FZIVGEAJDVOEKM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=C2N)F |
Computed by PubChem (NCBI)