Products 2225179-01-9
CAS 2225179-01-9 appears in our catalog under these names: (2–fluoro–4–(4–methylpiperazin–1–yl)phenyl)boronic acid, (2-Fluoro-4-(4-methylpiperazin-1-yl)phenyl)boronic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 500mg.
[2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]boronic acid (CAS 2225179-01-9) is a chemical compound with the molecular formula C11H16BFN2O2 and a molecular weight of 238.07 g/mol. IUPAC name: [2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]boronic acid. InChIKey: ZFHDVSVZKUZPSA-UHFFFAOYSA-N.
| Molecular formula | C11H16BFN2O2 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | [2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | ZFHDVSVZKUZPSA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCN(CC2)C)F)(O)O |
Computed by PubChem (NCBI)