CAS 944401-71-2 appears in our catalog under these names: 4-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 97%, 6-Amino-4-fluoropyridine-3-boronic acid pinacol ester, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 944401-71-2) is a chemical compound with the molecular formula C11H16BFN2O2 and a molecular weight of 238.07 g/mol. IUPAC name: 4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: VRAOZHCCDMWQFX-UHFFFAOYSA-N.
| Molecular formula | C11H16BFN2O2 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | VRAOZHCCDMWQFX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2F)N |
Computed by PubChem (NCBI)