Products 1706436-34-1
CAS 1706436-34-1 is the registry number for tert-Butyl 5-nitro-2-oxopyridine-1(2h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 5-nitro-2-oxopyridine-1-carboxylate (CAS 1706436-34-1) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: tert-butyl 5-nitro-2-oxopyridine-1-carboxylate. InChIKey: DBTYBWOAVHSVOL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O5 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | tert-butyl 5-nitro-2-oxopyridine-1-carboxylate |
| InChIKey | DBTYBWOAVHSVOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=CC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)