Products 356769-70-5

CAS 356769-70-5 is the registry number for 4-(2-(2-Methylfuran-3-carbonyl)hydrazinyl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-4-oxobutanoic acid (CAS 356769-70-5) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: 4-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-4-oxobutanoic acid. InChIKey: CJEOHRHZRDYBBE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N2O5
Molecular weight240.21 g/mol
IUPAC name4-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-4-oxobutanoic acid
InChIKeyCJEOHRHZRDYBBE-UHFFFAOYSA-N
SMILESCC1=C(C=CO1)C(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)