Products 59820-33-6
CAS 59820-33-6 appears in our catalog under these names: 4'-(2-Hydroxyethoxy)-3'-nitroacetanilide, 95%, 4-(2-Hydroxyethoxy)-3-nitroacetanilide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2000mg, 1000mg.
N-[4-(2-hydroxyethoxy)-3-nitrophenyl]acetamide (CAS 59820-33-6) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: N-[4-(2-hydroxyethoxy)-3-nitrophenyl]acetamide. InChIKey: BKDUSJRNVDOBMP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O5 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | N-[4-(2-hydroxyethoxy)-3-nitrophenyl]acetamide |
| InChIKey | BKDUSJRNVDOBMP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)OCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)