Products 1015895-20-1

CAS 1015895-20-1 is the registry number for Dimethyl 1-(2-oxopropyl)-1h-pyrazole-3,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 1-(2-oxopropyl)pyrazole-3,5-dicarboxylate (CAS 1015895-20-1) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: dimethyl 1-(2-oxopropyl)pyrazole-3,5-dicarboxylate. InChIKey: DJVLPEWBRCNBFG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N2O5
Molecular weight240.21 g/mol
IUPAC namedimethyl 1-(2-oxopropyl)pyrazole-3,5-dicarboxylate
InChIKeyDJVLPEWBRCNBFG-UHFFFAOYSA-N
SMILESCC(=O)CN1C(=CC(=N1)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)