Products 854357-45-2
CAS 854357-45-2 appears in our catalog under these names: 2-[(2-Methoxyethyl)amino]-5-nitrobenzoic acid, 95%, 2-((2-Methoxyethyl)amino)-5-nitrobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
2-(2-methoxyethylamino)-5-nitrobenzoic acid (CAS 854357-45-2) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: 2-(2-methoxyethylamino)-5-nitrobenzoic acid. InChIKey: DNPQOPWOYVMQNL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O5 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-(2-methoxyethylamino)-5-nitrobenzoic acid |
| InChIKey | DNPQOPWOYVMQNL-UHFFFAOYSA-N |
| SMILES | COCCNC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)