CAS 1707563-16-3 is the registry number for 1–(1–acetylpiperidin–4–yl)–1H–1,2,3–triazole–4–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
1-(1-acetylpiperidin-4-yl)triazole-4-carboxylic acid (CAS 1707563-16-3) is a chemical compound with the molecular formula C10H14N4O3 and a molecular weight of 238.24 g/mol. IUPAC name: 1-(1-acetylpiperidin-4-yl)triazole-4-carboxylic acid. InChIKey: DTPRFIQBRHQDQL-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1-(1-acetylpiperidin-4-yl)triazole-4-carboxylic acid |
| InChIKey | DTPRFIQBRHQDQL-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(CC1)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)