Products 1707585-54-3
CAS 1707585-54-3 is the registry number for 2-Chloro-4-phenyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-4-phenyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile (CAS 1707585-54-3) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 2-chloro-4-phenyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile. InChIKey: XOROELUGZUBZCY-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 2-chloro-4-phenyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile |
| InChIKey | XOROELUGZUBZCY-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1N=C(C(=C2C3=CC=CC=C3)C#N)Cl |
Computed by PubChem (NCBI)