Products 1707602-67-2
CAS 1707602-67-2 is the registry number for 3-(2-Aminoethyl)-1H-indol-6-ol, oxalic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2-aminoethyl)-1H-indol-6-ol;oxalic acid (CAS 1707602-67-2) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indol-6-ol;oxalic acid. InChIKey: FTEPWICENSPALG-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-indol-6-ol;oxalic acid |
| InChIKey | FTEPWICENSPALG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)NC=C2CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)