CAS 170872-87-4 is the registry number for (2R,3S)-2-(Tert-butoxycarbonyl-(methyl)-amino)-3-hydroxy-butanoic acid. Offered by: Creative Peptides. Available pack sizes: on request.
3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 170872-87-4) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: 3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: NHXZARPGSOCYMJ-UHFFFAOYSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | NHXZARPGSOCYMJ-UHFFFAOYSA-N |
| SMILES | CC(C(C(=O)O)N(C)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)