CAS 17090-15-2 appears in our catalog under these names: N–(3–Nitrophenyl)acrylamide, N-(3-Nitrophenyl)acrylamide 97%, N-(3-Nitrophenyl)acrylamide, 98%, 98%, N-(3-Nitrophenyl)acrylamide, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
N-(3-nitrophenyl)prop-2-enamide (CAS 17090-15-2) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: N-(3-nitrophenyl)prop-2-enamide. InChIKey: PJASPDPXLKIZHB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | N-(3-nitrophenyl)prop-2-enamide |
| InChIKey | PJASPDPXLKIZHB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)