Products 17097-90-4
CAS 17097-90-4 appears in our catalog under these names: 3-Ethoxy-3-oxo-2-phenyl propanoic acid, 3-Ethoxy-3-oxo-2-phenylpropanoic acid, 3-Ethoxy-3-oxo-2-phenylpropanoic acid 95%, 3-Ethoxy-3-oxo-2-phenylpropanoic acid, 95%, 95%, 3-Ethoxy-3-oxo-2-phenylpropanoic acid, 95%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 1g, 250mg.
3-ethoxy-3-oxo-2-phenylpropanoic acid (CAS 17097-90-4) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3-ethoxy-3-oxo-2-phenylpropanoic acid. InChIKey: INQWZSLKTMTMSK-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-ethoxy-3-oxo-2-phenylpropanoic acid |
| InChIKey | INQWZSLKTMTMSK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-ethoxy-3-oxo-2-phenylpropanoic acid, 2-Phenyl-malonic acid monoethyl ester, Leucogen Impurity 7, ethyl 2-phenylmalonate, Maybridge3_005541, ethyl hydrogen phenylmalonate, Propanedioic acid, 2-phenyl-, 1-ethyl ester, Oprea1_116521, phenyl malonic acid ethyl ester, phenyl(ethoxycarbonyl)acetic acid