CAS 17100-63-9 appears in our catalog under these names: Methyl 4–bromo–3–methoxybenzoate, Methyl 4-bromo-3-methoxybenzoate 97%, Methyl 4-bromo-3-methoxybenzoate, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 250mg, 1g, 5g, 10g, 500g.
Methyl 4-bromo-3-methoxybenzoate (CAS 17100-63-9) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: methyl 4-bromo-3-methoxybenzoate. InChIKey: XLKDKHRGIJWOSN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | methyl 4-bromo-3-methoxybenzoate |
| InChIKey | XLKDKHRGIJWOSN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)