CAS 17133-79-8 appears in our catalog under these names: 3-(Nitromethyl)-1lambda6-thiolane-1,1-dione, 95%, 3-(Nitromethyl)-1λâ¶-thiolane-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(nitromethyl)thiolane 1,1-dioxide (CAS 17133-79-8) is a chemical compound with the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. IUPAC name: 3-(nitromethyl)thiolane 1,1-dioxide. InChIKey: CWRINNZCUJIOSC-UHFFFAOYSA-N.
| Molecular formula | C5H9NO4S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 3-(nitromethyl)thiolane 1,1-dioxide |
| InChIKey | CWRINNZCUJIOSC-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1C[N+](=O)[O-] |
Computed by PubChem (NCBI)