Products 17175-16-5
CAS 17175-16-5 appears in our catalog under these names: Methyl (4-nitrophenyl) carbonate, 98%, 98%, Methyl (4-nitrophenyl) carbonate, 95%, Methyl (4-nitrophenyl) carbonate, 98%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 500g, 5g, 25g, 100g, 250mg, 1g.
Methyl (4-nitrophenyl) carbonate (CAS 17175-16-5) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: methyl (4-nitrophenyl) carbonate. InChIKey: BKNCSPZEGXUNTP-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | methyl (4-nitrophenyl) carbonate |
| InChIKey | BKNCSPZEGXUNTP-UHFFFAOYSA-N |
| SMILES | COC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Methyl-4-nitrophenylcarbonate, Carbonic acid, methyl 4-nitrophenyl ester, methyl (4-nitrophenyl) carbonate, Methyl p-nitrophenyl carbonate, Methyl 4-nitrophenyl carbonate, Carbonic acid methyl p-nitrophenyl ester, Carbonic acid methyl 4-nitrophenyl ester, Carbonic acid methyl=4-nitrophenyl ester, Carbonic acid methyl(p-nitrophenyl) ester, Carbonic acid, methyl p-nitrophenyl ester