Products 171777-67-6
CAS 171777-67-6 is the registry number for 4-Nitrobenzoyl-d4 Chloride. Offered by: TRC. Available pack sizes: 5g.
2,3,5,6-tetradeuterio-4-nitrobenzoyl chloride (CAS 171777-67-6) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 189.59 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-nitrobenzoyl chloride. InChIKey: SKDHHIUENRGTHK-RHQRLBAQSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 189.59 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-nitrobenzoyl chloride |
| InChIKey | SKDHHIUENRGTHK-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)Cl)[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)