Products 448199-09-5
CAS 448199-09-5 appears in our catalog under these names: 3-[(4-Hydroxybenzoyl)amino]-3-phenylpropanoic acid, 95%, 3-((4-Hydroxyphenyl)formamido)-3-phenylpropanoic acid, 95%, 3-((4-Hydroxyphenyl)formamido)-3-phenylpropanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[(4-hydroxybenzoyl)amino]-3-phenylpropanoic acid (CAS 448199-09-5) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 3-[(4-hydroxybenzoyl)amino]-3-phenylpropanoic acid. InChIKey: WTUXUCKXLVZSCH-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 3-[(4-hydroxybenzoyl)amino]-3-phenylpropanoic acid |
| InChIKey | WTUXUCKXLVZSCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)NC(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)