CAS 17213-57-9 appears in our catalog under these names: 3,5-Dimethoxybenzoyl chloride, 98%, 3,5-Dimethoxybenzoyl Chloride, 3,5–Dimethoxybenzoyl Chloride, 3,5-Dimethoxybenzoyl Chloride, >98.0%(GC)(T), 3,5-Dimethoxybenzoyl chloride 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 100mg, 500mg, 50mg, 10G, 1g.
3,5-dimethoxybenzoyl chloride (CAS 17213-57-9) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 3,5-dimethoxybenzoyl chloride. InChIKey: FTHPLWDYWAKYCY-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3,5-dimethoxybenzoyl chloride |
| InChIKey | FTHPLWDYWAKYCY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)Cl)OC |
Computed by PubChem (NCBI)