CAS 172216-98-7 appears in our catalog under these names: 7-(Trifluoromethyl)-1H-indole-2-carboxylic acid, 98%, 98%, 7–(Trifluoromethyl)–1H–indole–2–carboxylic acid, 7-(Trifluoromethyl)-1H-indole-2-carboxylic acid, 7-Trifluoromethyl-1H-indole-2-carboxylic acid, 98%, 7-(Trifluoromethyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 5g.
7-(trifluoromethyl)-1H-indole-2-carboxylic acid (CAS 172216-98-7) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 7-(trifluoromethyl)-1H-indole-2-carboxylic acid. InChIKey: PISPPXUYIZNQMU-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 7-(trifluoromethyl)-1H-indole-2-carboxylic acid |
| InChIKey | PISPPXUYIZNQMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(F)(F)F)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)