Products 172647-94-8

CAS 172647-94-8 is the registry number for Methyl 2-(1h-pyrrolo[2,3-b]pyridin-1-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-pyrrolo[2,3-b]pyridin-1-ylacetate (CAS 172647-94-8) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 2-pyrrolo[2,3-b]pyridin-1-ylacetate. InChIKey: BOKGUZZEEWDHPT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O2
Molecular weight190.20 g/mol
IUPAC namemethyl 2-pyrrolo[2,3-b]pyridin-1-ylacetate
InChIKeyBOKGUZZEEWDHPT-UHFFFAOYSA-N
SMILESCOC(=O)CN1C=CC2=C1N=CC=C2

Computed by PubChem (NCBI)