CAS 22316-27-4 appears in our catalog under these names: Clobazam impurity 4, 7-Deschloro-8-chloro Clobazam. Offered by: MedChemExpress, TRC. Available pack sizes: Get quote, 100mg.
7-chloro-5-methyl-1-phenyl-1,5-benzodiazepine-2,4-dione (CAS 22316-27-4) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 300.74 g/mol. IUPAC name: 7-chloro-5-methyl-1-phenyl-1,5-benzodiazepine-2,4-dione. InChIKey: CFQSNGPGPDIAQQ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 7-chloro-5-methyl-1-phenyl-1,5-benzodiazepine-2,4-dione |
| InChIKey | CFQSNGPGPDIAQQ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(=O)N(C2=C1C=C(C=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)