CAS 3294-96-0 appears in our catalog under these names: 3-Deshydroxy-4,5-dihydro-3-oxo Temazepam, 3-Deshydroxy-4,5-dihydro-3-oxo temazepam-13C, d3. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
7-chloro-1-methyl-5-phenyl-4,5-dihydro-1,4-benzodiazepine-2,3-dione (CAS 3294-96-0) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 300.74 g/mol. IUPAC name: 7-chloro-1-methyl-5-phenyl-4,5-dihydro-1,4-benzodiazepine-2,3-dione. InChIKey: DWYGNQZEEWSLJG-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 7-chloro-1-methyl-5-phenyl-4,5-dihydro-1,4-benzodiazepine-2,3-dione |
| InChIKey | DWYGNQZEEWSLJG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(NC(=O)C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)