CAS 173192-07-9 is the registry number for 5-(4-Hydroxyphenyl)-2,2-dimethyl-1,3-dioxolan-4-one. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
5-(4-hydroxyphenyl)-2,2-dimethyl-1,3-dioxolan-4-one (CAS 173192-07-9) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 5-(4-hydroxyphenyl)-2,2-dimethyl-1,3-dioxolan-4-one. InChIKey: PNANLKPPNQXKBJ-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)-2,2-dimethyl-1,3-dioxolan-4-one |
| InChIKey | PNANLKPPNQXKBJ-UHFFFAOYSA-N |
| SMILES | CC1(OC(C(=O)O1)C2=CC=C(C=C2)O)C |
Computed by PubChem (NCBI)