CAS 17326-22-6 is the registry number for 2-chloro-9-methyl-4H-pyrido(1,2-a)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-9-methylpyrido[1,2-a]pyrimidin-4-one (CAS 17326-22-6) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-9-methylpyrido[1,2-a]pyrimidin-4-one. InChIKey: TWSQBKNZAQIZSI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-9-methylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | TWSQBKNZAQIZSI-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=CC2=O)Cl |
Computed by PubChem (NCBI)