CAS 17412-23-6 appears in our catalog under these names: 6-Chloro-2,8-dimethylimidazo(1,2-b)pyridazine, 6-Chloro-2,8-dimethylimidazo[1,2-b]pyridazine, 95%, Risdiplam Impurity 3, 6-Chloro-2,8-dimethylimidazo[1,2-b]pyridazine 98%, 6-Chloro-2,8-dimethylimidazo[1,2-b]pyridazine, 98%, 98%. Offered by: Biosynth, Combi-blocks, Chemat Brand, Ambeed, Chemat. Available pack sizes: 0,5g, 5g, 250mg, 1g, on request, 50mg, 100mg, 10g.
6-chloro-2,8-dimethylimidazo[1,2-b]pyridazine (CAS 17412-23-6) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 6-chloro-2,8-dimethylimidazo[1,2-b]pyridazine. InChIKey: IMIMAKIVWDNARJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 6-chloro-2,8-dimethylimidazo[1,2-b]pyridazine |
| InChIKey | IMIMAKIVWDNARJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN2C1=NC(=C2)C)Cl |
Computed by PubChem (NCBI)