Products 174180-54-2
CAS 174180-54-2 appears in our catalog under these names: Benzyl 1–Benzyl–1H–indazole–3–carboxylate, Benzyl 1-Benzyl-1H-indazole-3-carboxylate, >97%, >97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
Benzyl 1-benzylindazole-3-carboxylate (CAS 174180-54-2) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: benzyl 1-benzylindazole-3-carboxylate. InChIKey: PBFSDBVIGNCTEE-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | benzyl 1-benzylindazole-3-carboxylate |
| InChIKey | PBFSDBVIGNCTEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=N2)C(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)