Products 1446648-15-2
CAS 1446648-15-2 is the registry number for GAT228. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 100mg, 1 mg.
3-[(1R)-2-nitro-1-phenylethyl]-2-phenyl-1H-indole (CAS 1446648-15-2) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 3-[(1R)-2-nitro-1-phenylethyl]-2-phenyl-1H-indole. InChIKey: OHZDCJJHWPHZJD-LJQANCHMSA-N.
| Molecular formula | C22H18N2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 3-[(1R)-2-nitro-1-phenylethyl]-2-phenyl-1H-indole |
| InChIKey | OHZDCJJHWPHZJD-LJQANCHMSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)[C@H](C[N+](=O)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)