CAS 17423-48-2 is the registry number for 4-Aminophenanthrene. Offered by: TRC. Available pack sizes: 100mg.
Phenanthren-4-amine (CAS 17423-48-2) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: phenanthren-4-amine. InChIKey: AFPNTTFBCMSLLO-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | phenanthren-4-amine |
| InChIKey | AFPNTTFBCMSLLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=CC=C3)N |
Computed by PubChem (NCBI)