CAS 174274-98-7 appears in our catalog under these names: 1,2-Dimethyl-1h-indol-5-amine hydrochloride, 95%, 1,2-Dimethyl-1H-indol-5-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1,2-dimethylindol-5-amine;hydrochloride (CAS 174274-98-7) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 1,2-dimethylindol-5-amine;hydrochloride. InChIKey: IWRYMFGOQZDKJH-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1,2-dimethylindol-5-amine;hydrochloride |
| InChIKey | IWRYMFGOQZDKJH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C)C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)