Products 174884-10-7

CAS 174884-10-7 is the registry number for 4-(3-Formylphenoxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(3-formylphenoxy)butanoic acid (CAS 174884-10-7) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(3-formylphenoxy)butanoic acid. InChIKey: QHLKXVXBJDXSHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O4
Molecular weight208.21 g/mol
IUPAC name4-(3-formylphenoxy)butanoic acid
InChIKeyQHLKXVXBJDXSHQ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OCCCC(=O)O)C=O

Computed by PubChem (NCBI)