CAS 174913-21-4 is the registry number for 5-Bromo-1,2-dichloro-3-methoxybenzene. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1,2-dichloro-3-methoxybenzene (CAS 174913-21-4) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: 5-bromo-1,2-dichloro-3-methoxybenzene. InChIKey: VUKSMXAKPWKRFD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | 5-bromo-1,2-dichloro-3-methoxybenzene |
| InChIKey | VUKSMXAKPWKRFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)