Products 2248255-27-6
CAS 2248255-27-6 is the registry number for 2-Cyclopropyl-4H-benzo[4,5]imidazo[2,1-b][1,3]thiazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-cyclopropyl-[1,3]thiazino[3,2-a]benzimidazol-4-one (CAS 2248255-27-6) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 2-cyclopropyl-[1,3]thiazino[3,2-a]benzimidazol-4-one. InChIKey: KVDRYHZQXJQEMO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 2-cyclopropyl-[1,3]thiazino[3,2-a]benzimidazol-4-one |
| InChIKey | KVDRYHZQXJQEMO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=O)N3C4=CC=CC=C4N=C3S2 |
Computed by PubChem (NCBI)