CAS 175202-94-5 appears in our catalog under these names: 2-[1-Methyl-3-(trifluoromethyl)pyrazol-5-yl]-thiophene-5-carboxaldehyde, 95%, 5-(1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)thiophene-2-carbaldehyde 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 500mg, 50mg, 1g, 100mg, 250mg.
5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-carbaldehyde (CAS 175202-94-5) is a chemical compound with the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. IUPAC name: 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-carbaldehyde. InChIKey: ZAZOCQFBLVVZPT-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2OS |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-carbaldehyde |
| InChIKey | ZAZOCQFBLVVZPT-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=C(S2)C=O |
Computed by PubChem (NCBI)