CAS 325996-04-1 appears in our catalog under these names: 2-((3-(Trifluoromethyl)phenyl)imino)thiazolidin-4-one, 97%, 2-{(3-(Trifluoromethyl)phenyl)amino}-4,5-dihydro-1,3-thiazol-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 5g.
2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one (CAS 325996-04-1) is a chemical compound with the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one. InChIKey: CRWZRQBAORPLIN-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2OS |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
| InChIKey | CRWZRQBAORPLIN-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=NC2=CC=CC(=C2)C(F)(F)F)S1 |
Computed by PubChem (NCBI)