CAS 314282-42-3 is the registry number for N-(3-Cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,2,2-trifluoroacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,2,2-trifluoroacetamide (CAS 314282-42-3) is a chemical compound with the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. IUPAC name: N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,2,2-trifluoroacetamide. InChIKey: QWZHTJXNBFZNCN-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2OS |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,2,2-trifluoroacetamide |
| InChIKey | QWZHTJXNBFZNCN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C#N)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)