CAS 1909309-36-9 is the registry number for {3-(2-(Trifluoromethyl)phenyl)-1,2,4-thiadiazol-5-yl}methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[3-[2-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]methanol (CAS 1909309-36-9) is a chemical compound with the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. IUPAC name: [3-[2-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]methanol. InChIKey: WAORSBGOLHKCBR-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2OS |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | [3-[2-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]methanol |
| InChIKey | WAORSBGOLHKCBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NSC(=N2)CO)C(F)(F)F |
Computed by PubChem (NCBI)