Products 852389-02-7
CAS 852389-02-7 is the registry number for 2-Sulfanyl-1-(2-(trifluoromethyl)phenyl)-4,5-dihydro-1H-imidazol-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-sulfanylidene-3-[2-(trifluoromethyl)phenyl]imidazolidin-4-one (CAS 852389-02-7) is a chemical compound with the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. IUPAC name: 2-sulfanylidene-3-[2-(trifluoromethyl)phenyl]imidazolidin-4-one. InChIKey: KGXRJPBGYNJIDQ-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2OS |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 2-sulfanylidene-3-[2-(trifluoromethyl)phenyl]imidazolidin-4-one |
| InChIKey | KGXRJPBGYNJIDQ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)N1)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)