CAS 175204-44-1 appears in our catalog under these names: Opicapone Impurity 7, 2,5-Dichloro-4,6-dimethylnicotinamide 95%, 2,5-Dichloro-4,6-dimethylnicotinamide, 95%, 95%, 2,5-Dichloro-4,6-dimethylnicotinamide, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
2,5-dichloro-4,6-dimethylpyridine-3-carboxamide (CAS 175204-44-1) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2,5-dichloro-4,6-dimethylpyridine-3-carboxamide. InChIKey: IHXGELAZSSLGOE-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2,5-dichloro-4,6-dimethylpyridine-3-carboxamide |
| InChIKey | IHXGELAZSSLGOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Cl)C)Cl)C(=O)N |
Computed by PubChem (NCBI)