CAS 175205-38-6 is the registry number for 2-Chloro-4-(trifluoromethyl)phenyl isothiocyanate, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-chloro-1-isothiocyanato-4-(trifluoromethyl)benzene (CAS 175205-38-6) is a chemical compound with the molecular formula C8H3ClF3NS and a molecular weight of 237.63 g/mol. IUPAC name: 2-chloro-1-isothiocyanato-4-(trifluoromethyl)benzene. InChIKey: AZNMQMFLAAJBBT-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NS |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 2-chloro-1-isothiocyanato-4-(trifluoromethyl)benzene |
| InChIKey | AZNMQMFLAAJBBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)N=C=S |
Computed by PubChem (NCBI)