CAS 99195-86-5 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)phenyl isothiocyanate, 95%, 4-Chloro-2-(trifluoromethyl)phenylisothiocyanate, 97%, 4-Chloro-2-(trifluoromethyl)phenyl isothiocyanate, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg.
4-chloro-1-isothiocyanato-2-(trifluoromethyl)benzene (CAS 99195-86-5) is a chemical compound with the molecular formula C8H3ClF3NS and a molecular weight of 237.63 g/mol. IUPAC name: 4-chloro-1-isothiocyanato-2-(trifluoromethyl)benzene. InChIKey: OOJRRHXHHCEPTA-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NS |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 4-chloro-1-isothiocyanato-2-(trifluoromethyl)benzene |
| InChIKey | OOJRRHXHHCEPTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)