CAS 23165-49-3 appears in our catalog under these names: 2-Chloro-5-(trifluoromethyl)phenyl isothiocyanate, 95%, 2-Chloro-5-(trifluoromethyl)phenyl isothiocyanate, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
1-chloro-2-isothiocyanato-4-(trifluoromethyl)benzene (CAS 23165-49-3) is a chemical compound with the molecular formula C8H3ClF3NS and a molecular weight of 237.63 g/mol. IUPAC name: 1-chloro-2-isothiocyanato-4-(trifluoromethyl)benzene. InChIKey: KHTMKXDMVYHDSY-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NS |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 1-chloro-2-isothiocyanato-4-(trifluoromethyl)benzene |
| InChIKey | KHTMKXDMVYHDSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N=C=S)Cl |
Computed by PubChem (NCBI)