Products 30613-71-9
CAS 30613-71-9 appears in our catalog under these names: 2-Chloro-4-isothiocyanato-1-(trifluoromethyl)benzene, 98%, 3-Chloro-4-(trifluoromethyl)phenyl Isothiocyanate, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2-chloro-4-isothiocyanato-1-(trifluoromethyl)benzene (CAS 30613-71-9) is a chemical compound with the molecular formula C8H3ClF3NS and a molecular weight of 237.63 g/mol. IUPAC name: 2-chloro-4-isothiocyanato-1-(trifluoromethyl)benzene. InChIKey: SHISNXOMWZVBTC-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NS |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 2-chloro-4-isothiocyanato-1-(trifluoromethyl)benzene |
| InChIKey | SHISNXOMWZVBTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=S)Cl)C(F)(F)F |
Computed by PubChem (NCBI)