CAS 688763-26-0 is the registry number for 2-Chloro-6-(trifluoromethyl)phenylisothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2-isothiocyanato-3-(trifluoromethyl)benzene (CAS 688763-26-0) is a chemical compound with the molecular formula C8H3ClF3NS and a molecular weight of 237.63 g/mol. IUPAC name: 1-chloro-2-isothiocyanato-3-(trifluoromethyl)benzene. InChIKey: MUOPLEXRHZBHEU-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NS |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 1-chloro-2-isothiocyanato-3-(trifluoromethyl)benzene |
| InChIKey | MUOPLEXRHZBHEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N=C=S)C(F)(F)F |
Computed by PubChem (NCBI)