CAS 175675-63-5 appears in our catalog under these names: (E)-3-(3-(Trifluoromethoxy)phenyl)acrylic acid, 98%, 3-(Trifluoromethoxy)cinnamic acid, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoic acid (CAS 175675-63-5) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: (E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoic acid. InChIKey: CLKZZEYGXRWYNI-SNAWJCMRSA-N.
| Molecular formula | C10H7F3O3 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | (E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| InChIKey | CLKZZEYGXRWYNI-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)