Products 2270905-74-1

CAS 2270905-74-1 is the registry number for 4-Acetyl-2-trifluoromethyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-acetyl-2-(trifluoromethyl)benzoic acid (CAS 2270905-74-1) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: 4-acetyl-2-(trifluoromethyl)benzoic acid. InChIKey: KMEUEAOMAZHEOK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3O3
Molecular weight232.16 g/mol
IUPAC name4-acetyl-2-(trifluoromethyl)benzoic acid
InChIKeyKMEUEAOMAZHEOK-UHFFFAOYSA-N
SMILESCC(=O)C1=CC(=C(C=C1)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)